cas: 1893340-46-9 — see every product listed under this CAS number, including other names
tert-Butyl (R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate, 97% (CAS 1893340-46-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A820744-10g |
| cas | 1893340-46-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 26695.90 Pln | |
| Fluorochem | 100mg | 1497.41 Pln | |
| Fluorochem | 250mg | 2903.16 Pln | |
| Fluorochem | 500mg | 4730.64 Pln | |
| Fluorochem | 1g | 7552.57 Pln | |
| Fluorochem | 5g | 22667.04 Pln | |
| Ambeed | 250mg | 2523.06 Pln | |
| Ambeed | 1g | 6211.00 Pln | |
| Ambeed | 5g | 18504.12 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 1893340-46-9) is a chemical compound with the molecular formula C10H18FNO3 and a molecular weight of 219.25 g/mol. IUPAC name: tert-butyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: HMMKNNFZSSJGNC-SNVBAGLBSA-N.
| Molecular formula | C10H18FNO3 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | tert-butyl (3R)-3-fluoro-3-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | HMMKNNFZSSJGNC-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@](C1)(CO)F |
Computed by PubChem (NCBI)