cas: 111300-06-2 — see every product listed under this CAS number, including other names
tert-Butyl (trans-4-hydroxycyclohexyl)carbamate 95% (CAS 111300-06-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A149616-1g |
| cas | 111300-06-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 754.19 Pln | |
| Ambeed | 1000g | 1416.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A149616 |
Tert-butyl N-(4-hydroxycyclohexyl)carbamate (CAS 111300-06-2) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl N-(4-hydroxycyclohexyl)carbamate. InChIKey: DQARDWKWPIRJEH-UHFFFAOYSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl N-(4-hydroxycyclohexyl)carbamate |
| InChIKey | DQARDWKWPIRJEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)O |
Computed by PubChem (NCBI)