cas: 172348-63-9 — see every product listed under this CAS number, including other names
tert-Butyl (trans-4-hydroxymethylcyclohexylmethyl)carbamate, 97.0% (CAS 172348-63-9) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 100 mg, 25 g, 500 mg, 5 g, 1 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W056647-10 g |
| cas | 172348-63-9 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 1582.86 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 25 g | 3045.72 Pln | |
| MedChemExpress | 500 mg | 384.71 Pln | |
| MedChemExpress | 5 g | 1007.00 Pln | |
| MedChemExpress | 1 g | 477.59 Pln | |
| MedChemExpress | 250 mg | 310.40 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
Tert-butyl N-[[4-(hydroxymethyl)cyclohexyl]methyl]carbamate (CAS 172348-63-9) is a chemical compound with the molecular formula C13H25NO3 and a molecular weight of 243.34 g/mol. IUPAC name: tert-butyl N-[[4-(hydroxymethyl)cyclohexyl]methyl]carbamate. InChIKey: KSXPGASLEFGROT-UHFFFAOYSA-N.
| Molecular formula | C13H25NO3 |
|---|---|
| Molecular weight | 243.34 g/mol |
| IUPAC name | tert-butyl N-[[4-(hydroxymethyl)cyclohexyl]methyl]carbamate |
| InChIKey | KSXPGASLEFGROT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC1)CO |
Computed by PubChem (NCBI)