cas: 619333-95-8 — see every product listed under this CAS number, including other names
tert-Butyl [bis(4-methoxyphenyl)phosphinyloxy]carbamate (CAS 619333-95-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F636367-250MG |
| cas | 619333-95-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 2044.09 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl N-bis(4-methoxyphenyl)phosphoryloxycarbamate (CAS 619333-95-8) is a chemical compound with the molecular formula C19H24NO6P and a molecular weight of 393.4 g/mol. IUPAC name: tert-butyl N-bis(4-methoxyphenyl)phosphoryloxycarbamate. InChIKey: BNMBQDIFMJFRAF-UHFFFAOYSA-N.
| Molecular formula | C19H24NO6P |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | tert-butyl N-bis(4-methoxyphenyl)phosphoryloxycarbamate |
| InChIKey | BNMBQDIFMJFRAF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NOP(=O)(C1=CC=C(C=C1)OC)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)