cas: 1148044-31-8 — see every product listed under this CAS number, including other names
tert-Butyl 1,6-diazaspiro[3.4]octane-1-carboxylate 98% (CAS 1148044-31-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A601262-50mg |
| cas | 1148044-31-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 642.94 Pln | |
| Ambeed | 100mg | 893.25 Pln | |
| Ambeed | 250mg | 1588.56 Pln | |
| Ambeed | 1g | 3869.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A601262 |
Tert-butyl 1,7-diazaspiro[3.4]octane-1-carboxylate (CAS 1148044-31-8) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl 1,7-diazaspiro[3.4]octane-1-carboxylate. InChIKey: OJDKDBHLSUSOBW-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl 1,7-diazaspiro[3.4]octane-1-carboxylate |
| InChIKey | OJDKDBHLSUSOBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC12CCNC2 |
Computed by PubChem (NCBI)