cas: 1100748-84-2 — see every product listed under this CAS number, including other names
tert-Butyl 1-amino-7-azaspiro[3.5]nonane-7-carboxylate, 95%, 95% (CAS 1100748-84-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119TT2-50mg |
| cas | 1100748-84-2 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 246.80 Pln | |
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 626.00 Pln | |
| Chemat | 1g | 1470.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate (CAS 1100748-84-2) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate. InChIKey: FGWHJPYFWUDBIX-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl 3-amino-7-azaspiro[3.5]nonane-7-carboxylate |
| InChIKey | FGWHJPYFWUDBIX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC2N)CC1 |
Computed by PubChem (NCBI)