cas: 1415800-38-2 — see every product listed under this CAS number, including other names
tert-Butyl 1-bromo-3,6,9,12,15-pentaoxaoctadecan-18-oate, 97% (CAS 1415800-38-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867286-1G |
| cas | 1415800-38-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 1356.83 Pln | |
| Fluorochem | 25g | 4610.89 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1415800-38-2) is a chemical compound with the molecular formula C17H33BrO7 and a molecular weight of 429.3 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: CFAPOEDUPYZKFH-UHFFFAOYSA-N.
| Molecular formula | C17H33BrO7 |
|---|---|
| Molecular weight | 429.3 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | CFAPOEDUPYZKFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCBr |
Computed by PubChem (NCBI)