cas: 374794-89-5 — see every product listed under this CAS number, including other names
tert-Butyl 1-oxa-8-azaspiro[4.5]decane-8-carboxylate, 95%, 95% (CAS 374794-89-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C894-100mg |
| cas | 374794-89-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 995.60 Pln | |
| Chemat | 5g | 3328.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 1-oxa-8-azaspiro[4.5]decane-8-carboxylate (CAS 374794-89-5) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl 1-oxa-8-azaspiro[4.5]decane-8-carboxylate. InChIKey: JLIBXBGSIZHAPD-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl 1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| InChIKey | JLIBXBGSIZHAPD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCO2)CC1 |
Computed by PubChem (NCBI)