tert-Butyl 10-bromodecanoate, 97%
cas: 1644575-06-3 — see every product listed under this CAS number, including other names
tert-Butyl 10-bromodecanoate, 97% (CAS 1644575-06-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F634414-100MG |
| cas | 1644575-06-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 466.52 Pln | |
| Fluorochem | 5g | 1637.98 Pln | |
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1633.06 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 1163.60 Pln | |
| Chemat | 10g | 1950.80 Pln | |
| Chemat | 25g | 3837.20 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl 10-bromodecanoate (CAS 1644575-06-3) is a chemical compound with the molecular formula C14H27BrO2 and a molecular weight of 307.27 g/mol. IUPAC name: tert-butyl 10-bromodecanoate. InChIKey: QQLXPUHVMNANLN-UHFFFAOYSA-N.
| Molecular formula | C14H27BrO2 |
|---|---|
| Molecular weight | 307.27 g/mol |
| IUPAC name | tert-butyl 10-bromodecanoate |
| InChIKey | QQLXPUHVMNANLN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCCCCCBr |
Computed by PubChem (NCBI)