tert-Butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-azaspiro[4.5]dec-2-ene-8-carboxylate, 95%
cas: 2411223-29-3 — see every product listed under this CAS number, including other names
tert-Butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-azaspiro[4.5]dec-2-ene-8-carboxylate, 95% (CAS 2411223-29-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1468241-50mg |
| cas | 2411223-29-3 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1610.81 Pln | |
| Ambeed | 100mg | 2389.56 Pln | |
| Ambeed | 250mg | 3941.50 Pln | |
| Ambeed | 1g | 11584.38 Pln | |
| BLDpharm | 50mg | 1730.53 Pln | |
| BLDpharm | 100mg | 2569.12 Pln | |
| BLDpharm | 250mg | 4246.31 Pln | |
| BLDpharm | 1g | 12487.85 Pln | |
| Chemat | 50mg | 1614.80 Pln | |
| Chemat | 100mg | 2397.20 Pln | |
| Chemat | 250mg | 3962.00 Pln | |
| Chemat | 1g | 11656.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-azaspiro[4.5]dec-2-ene-8-carboxylate (CAS 2411223-29-3) is a chemical compound with the molecular formula C20H34BNO4 and a molecular weight of 363.3 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-azaspiro[4.5]dec-2-ene-8-carboxylate. InChIKey: AKCOGLHBELLJME-UHFFFAOYSA-N.
| Molecular formula | C20H34BNO4 |
|---|---|
| Molecular weight | 363.3 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-8-azaspiro[4.5]dec-2-ene-8-carboxylate |
| InChIKey | AKCOGLHBELLJME-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC3(C2)CCN(CC3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)