cas: 1149333-40-3 — see every product listed under this CAS number, including other names
tert-Butyl 2-amino-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate, 96% (CAS 1149333-40-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F760837-100MG |
| cas | 1149333-40-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 758.08 Pln | |
| Fluorochem | 5g | 3569.59 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 1149333-40-3) is a chemical compound with the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. IUPAC name: tert-butyl 2-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: LVCYIRQQPQEBSD-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2 |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | tert-butyl 2-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | LVCYIRQQPQEBSD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=N2)N |
Computed by PubChem (NCBI)