CAS 1382948-48-2 appears in our catalog under these names: tert-Butyl 2-fluoro-5-iodobenzoate, 95%, tert-Butyl 2-fluoro-5-iodobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 100g, 1g, 5g.
Tert-butyl 2-fluoro-5-iodobenzoate (CAS 1382948-48-2) is a chemical compound with the molecular formula C11H12FIO2 and a molecular weight of 322.11 g/mol. IUPAC name: tert-butyl 2-fluoro-5-iodobenzoate. InChIKey: BDWSQTMRKXFBGN-UHFFFAOYSA-N.
| Molecular formula | C11H12FIO2 |
|---|---|
| Molecular weight | 322.11 g/mol |
| IUPAC name | tert-butyl 2-fluoro-5-iodobenzoate |
| InChIKey | BDWSQTMRKXFBGN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)I)F |
Computed by PubChem (NCBI)