cas: 1419101-54-4 — see every product listed under this CAS number, including other names
tert-Butyl 2-hydroxy-6-azaspiro[3.5]nonane-6-carboxylate, 97%, 97% (CAS 1419101-54-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112HDC-100mg |
| cas | 1419101-54-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 1g | 1235.60 Pln | |
| Chemat | 5g | 3746.00 Pln | |
| Chemat | 500mg | 803.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-hydroxy-6-azaspiro[3.5]nonane-6-carboxylate (CAS 1419101-54-4) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl 2-hydroxy-6-azaspiro[3.5]nonane-6-carboxylate. InChIKey: KSJLUFYKVIPHSC-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl 2-hydroxy-6-azaspiro[3.5]nonane-6-carboxylate |
| InChIKey | KSJLUFYKVIPHSC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CC(C2)O |
Computed by PubChem (NCBI)