cas: 392331-78-1 — see every product listed under this CAS number, including other names
tert-Butyl 2-oxo-1,7-diazaspiro[3.5]nonane-7-carboxylate 98% (CAS 392331-78-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A762947-250mg |
| cas | 392331-78-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 3079.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A762947 |
Tert-butyl 2-oxo-1,7-diazaspiro[3.5]nonane-7-carboxylate (CAS 392331-78-1) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl 2-oxo-1,7-diazaspiro[3.5]nonane-7-carboxylate. InChIKey: OXYVMJMQRLATGG-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl 2-oxo-1,7-diazaspiro[3.5]nonane-7-carboxylate |
| InChIKey | OXYVMJMQRLATGG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)N2 |
Computed by PubChem (NCBI)