cas: 1363381-43-4 — see every product listed under this CAS number, including other names
tert-Butyl 2-oxo-3-oxa-1,8-diazaspiro(5.5)undecane-8-carboxylate, 98+% (CAS 1363381-43-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A803047-1g |
| cas | 1363381-43-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 9210.04 Pln | |
| AmBeed | 10g | 28395.01 Pln | |
| AmBeed | 5g | 17061.10 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 2-oxo-3-oxa-1,8-diazaspiro[5.5]undecane-8-carboxylate (CAS 1363381-43-4) is a chemical compound with the molecular formula C13H22N2O4 and a molecular weight of 270.32 g/mol. IUPAC name: tert-butyl 2-oxo-3-oxa-1,8-diazaspiro[5.5]undecane-8-carboxylate. InChIKey: PSJVWIIBVVDMHJ-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O4 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | tert-butyl 2-oxo-3-oxa-1,8-diazaspiro[5.5]undecane-8-carboxylate |
| InChIKey | PSJVWIIBVVDMHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CCOC(=O)N2 |
Computed by PubChem (NCBI)