tert-Butyl 2-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indoline-3,4'-piperidine]-1'-carboxylate, 95%
cas: 1253288-12-8 — see every product listed under this CAS number, including other names
tert-Butyl 2-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indoline-3,4'-piperidine]-1'-carboxylate, 95% (CAS 1253288-12-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A301072-100mg |
| cas | 1253288-12-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 620.69 Pln | |
| Ambeed | 250mg | 1138.00 Pln | |
| Ambeed | 1g | 2728.88 Pln | |
| BLDpharm | 100mg | 664.24 Pln | |
| BLDpharm | 250mg | 1225.15 Pln | |
| BLDpharm | 1g | 2935.66 Pln | |
| Chemat | 100mg | 712.40 Pln | |
| Chemat | 250mg | 1331.60 Pln | |
| Chemat | 1g | 3218.00 Pln | |
| Fluorochem | 250mg | 2476.23 Pln | |
| Fluorochem | 1g | 5964.58 Pln | |
| Fluorochem | 100mg | 1320.39 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 2-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-1'-carboxylate (CAS 1253288-12-8) is a chemical compound with the molecular formula C23H33BN2O5 and a molecular weight of 428.3 g/mol. IUPAC name: tert-butyl 2-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-1'-carboxylate. InChIKey: WAFCDWZIYOONLR-UHFFFAOYSA-N.
| Molecular formula | C23H33BN2O5 |
|---|---|
| Molecular weight | 428.3 g/mol |
| IUPAC name | tert-butyl 2-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-1'-carboxylate |
| InChIKey | WAFCDWZIYOONLR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NC(=O)C34CCN(CC4)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)