cas: 1359704-84-9 — see every product listed under this CAS number, including other names
tert-Butyl 2-oxo-6-azaspiro[3.5]nonane-6-carboxylate, 97% (CAS 1359704-84-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F434605-100MG |
| cas | 1359704-84-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 378.01 Pln | |
| Fluorochem | 500mg | 612.30 Pln | |
| Fluorochem | 1g | 966.34 Pln | |
| Fluorochem | 2.5g | 2163.84 Pln | |
| Fluorochem | 5g | 2939.61 Pln | |
| Fluorochem | 10g | 5527.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-oxo-6-azaspiro[3.5]nonane-6-carboxylate (CAS 1359704-84-9) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: tert-butyl 2-oxo-6-azaspiro[3.5]nonane-6-carboxylate. InChIKey: HKTGLPAHDGZQDV-UHFFFAOYSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | tert-butyl 2-oxo-6-azaspiro[3.5]nonane-6-carboxylate |
| InChIKey | HKTGLPAHDGZQDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CC(=O)C2 |
Computed by PubChem (NCBI)