cas: 1209780-71-1 — see every product listed under this CAS number, including other names
tert-Butyl 3,3-difluoro-4-hydroxypiperidine-1-carboxylate, 95% (CAS 1209780-71-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227309-250MG |
| cas | 1209780-71-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 726.85 Pln | |
| Fluorochem | 10g | 1034.03 Pln | |
| Fluorochem | 25g | 2195.08 Pln | |
| Fluorochem | 100g | 8604.28 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3,3-difluoro-4-hydroxypiperidine-1-carboxylate (CAS 1209780-71-1) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl 3,3-difluoro-4-hydroxypiperidine-1-carboxylate. InChIKey: GISYXRBCSOIMTM-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-4-hydroxypiperidine-1-carboxylate |
| InChIKey | GISYXRBCSOIMTM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)(F)F)O |
Computed by PubChem (NCBI)