cas: 1434141-81-7 — see every product listed under this CAS number, including other names
tert-Butyl 3,3-difluoro-4-hydroxypyrrolidine-1-carboxylate, 95%, 95% (CAS 1434141-81-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110YAN-50mg |
| cas | 1434141-81-7 |
| size | 50mg |
| availability | 50g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 107.60 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1163.60 Pln | |
| Chemat | 10g | 1994.00 Pln | |
| Chemat | 25g | 4470.80 Pln | |
| Chemat | 50g | 5075.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3,3-difluoro-4-hydroxypyrrolidine-1-carboxylate (CAS 1434141-81-7) is a chemical compound with the molecular formula C9H15F2NO3 and a molecular weight of 223.22 g/mol. IUPAC name: tert-butyl 3,3-difluoro-4-hydroxypyrrolidine-1-carboxylate. InChIKey: MKRJRMARSARGCB-UHFFFAOYSA-N.
| Molecular formula | C9H15F2NO3 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | MKRJRMARSARGCB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C1)(F)F)O |
Computed by PubChem (NCBI)