cas: 1258638-32-2 — see every product listed under this CAS number, including other names
tert-Butyl 3,3-difluoro-5-hydroxypiperidine-1-carboxylate, 97% (CAS 1258638-32-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609553-100MG |
| cas | 1258638-32-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 763.29 Pln | |
| Fluorochem | 250mg | 1664.02 Pln | |
| Fluorochem | 1g | 4152.72 Pln | |
| Fluorochem | 5g | 16762.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3,3-difluoro-5-hydroxypiperidine-1-carboxylate (CAS 1258638-32-2) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl 3,3-difluoro-5-hydroxypiperidine-1-carboxylate. InChIKey: NCHCRPISXZGPTH-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-5-hydroxypiperidine-1-carboxylate |
| InChIKey | NCHCRPISXZGPTH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(C1)(F)F)O |
Computed by PubChem (NCBI)