cas: 2244699-82-7 — see every product listed under this CAS number, including other names
tert-Butyl 3-((4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)azetidine-1-carboxylate 95% (CAS 2244699-82-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A740596-100mg |
| cas | 2244699-82-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 609.56 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 2589.81 Pln | |
| Ambeed | 5g | 8875.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A740596 |
Tert-butyl 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]azetidine-1-carboxylate (CAS 2244699-82-7) is a chemical compound with the molecular formula C15H28BNO4 and a molecular weight of 297.20 g/mol. IUPAC name: tert-butyl 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]azetidine-1-carboxylate. InChIKey: ZBUVYHVQMDQQLA-UHFFFAOYSA-N.
| Molecular formula | C15H28BNO4 |
|---|---|
| Molecular weight | 297.20 g/mol |
| IUPAC name | tert-butyl 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]azetidine-1-carboxylate |
| InChIKey | ZBUVYHVQMDQQLA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)