cas: 1439824-04-0 — see every product listed under this CAS number, including other names
tert-Butyl 3-((di-tert-butoxycarbonyl)amino)-5-(1-hydroxyethyl)-1H-pyrazole-1-carboxylate 95% (CAS 1439824-04-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A393575-100mg |
| cas | 1439824-04-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1505.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A393575 |
Tert-butyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(1-hydroxyethyl)pyrazole-1-carboxylate (CAS 1439824-04-0) is a chemical compound with the molecular formula C20H33N3O7 and a molecular weight of 427.5 g/mol. IUPAC name: tert-butyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(1-hydroxyethyl)pyrazole-1-carboxylate. InChIKey: GZCNNOZZDUPMKM-UHFFFAOYSA-N.
| Molecular formula | C20H33N3O7 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | tert-butyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(1-hydroxyethyl)pyrazole-1-carboxylate |
| InChIKey | GZCNNOZZDUPMKM-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=NN1C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)