cas: 2304635-53-6 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azetidine-1-carboxylate, 97% (CAS 2304635-53-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F696787-100MG |
| cas | 2304635-53-6 |
| size | 100mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 367.60 Pln | |
| Fluorochem | 1g | 804.94 Pln | |
| Fluorochem | 5g | 1867.07 Pln | |
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 459.38 Pln | |
| Ambeed | 1g | 848.75 Pln | |
| Ambeed | 5g | 2612.06 Pln | |
| Ambeed | 10g | 4403.19 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azetidine-1-carboxylate (CAS 2304635-53-6) is a chemical compound with the molecular formula C14H26BNO4 and a molecular weight of 283.17 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azetidine-1-carboxylate. InChIKey: OGIREDKIFYTFOQ-UHFFFAOYSA-N.
| Molecular formula | C14H26BNO4 |
|---|---|
| Molecular weight | 283.17 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azetidine-1-carboxylate |
| InChIKey | OGIREDKIFYTFOQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)