cas: 832114-05-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzylcarbamate 98% (CAS 832114-05-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A656308-100mg |
| cas | 832114-05-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 648.50 Pln | |
| Ambeed | 25g | 2945.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A656308 |
Tert-butyl N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate (CAS 832114-05-3) is a chemical compound with the molecular formula C18H28BNO4 and a molecular weight of 333.2 g/mol. IUPAC name: tert-butyl N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate. InChIKey: ANBFXKONRFZJAO-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO4 |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | tert-butyl N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate |
| InChIKey | ANBFXKONRFZJAO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)