cas: 1622834-60-9 — see every product listed under this CAS number, including other names
tert-Butyl 3-(5-bromothiophen-2-yl)piperidine-1-carboxylate, 95%, 95% (CAS 1622834-60-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMPF-100mg |
| cas | 1622834-60-9 |
| size | 100mg |
| availability | 1.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1163.60 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(5-bromothiophen-2-yl)piperidine-1-carboxylate (CAS 1622834-60-9) is a chemical compound with the molecular formula C14H20BrNO2S and a molecular weight of 346.29 g/mol. IUPAC name: tert-butyl 3-(5-bromothiophen-2-yl)piperidine-1-carboxylate. InChIKey: XRYNOGWXAPZUGZ-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO2S |
|---|---|
| Molecular weight | 346.29 g/mol |
| IUPAC name | tert-butyl 3-(5-bromothiophen-2-yl)piperidine-1-carboxylate |
| InChIKey | XRYNOGWXAPZUGZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)