cas: 1160247-18-6 — see every product listed under this CAS number, including other names
tert-Butyl 3-(aminomethyl)-1-oxa-7-azaspiro[4.5]decane-7-carboxylate, 95%, 95% (CAS 1160247-18-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111BF0-50mg |
| cas | 1160247-18-6 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 496.40 Pln | |
| Chemat | 100mg | 798.80 Pln | |
| Chemat | 250mg | 1389.20 Pln | |
| Chemat | 1g | 3645.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(aminomethyl)-1-oxa-9-azaspiro[4.5]decane-9-carboxylate (CAS 1160247-18-6) is a chemical compound with the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. IUPAC name: tert-butyl 3-(aminomethyl)-1-oxa-9-azaspiro[4.5]decane-9-carboxylate. InChIKey: CYIJGWKOFZHWLD-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O3 |
|---|---|
| Molecular weight | 270.37 g/mol |
| IUPAC name | tert-butyl 3-(aminomethyl)-1-oxa-9-azaspiro[4.5]decane-9-carboxylate |
| InChIKey | CYIJGWKOFZHWLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CC(CO2)CN |
Computed by PubChem (NCBI)