cas: 411238-88-5 — see every product listed under this CAS number, including other names
tert-Butyl 3-(hydrazinecarbonyl)pyrrolidine-1-carboxylate, 98%, 98% (CAS 411238-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1184BN-100mg |
| cas | 411238-88-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 2104.40 Pln | |
| Chemat | 250mg | 304.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(hydrazinecarbonyl)pyrrolidine-1-carboxylate (CAS 411238-88-5) is a chemical compound with the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. IUPAC name: tert-butyl 3-(hydrazinecarbonyl)pyrrolidine-1-carboxylate. InChIKey: HFMHEXPZANOFSL-UHFFFAOYSA-N.
| Molecular formula | C10H19N3O3 |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | tert-butyl 3-(hydrazinecarbonyl)pyrrolidine-1-carboxylate |
| InChIKey | HFMHEXPZANOFSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C(=O)NN |
Computed by PubChem (NCBI)