cas: 253177-03-6 — see every product listed under this CAS number, including other names
tert-Butyl 3-(iodomethyl)piperidine-1-carboxylate, 95% (stabilized with Copper chip), 95% (stabilized with Copper chip) (CAS 253177-03-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BG7P-100mg |
| cas | 253177-03-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 501.20 Pln | |
| Chemat | 10g | 808.40 Pln | |
| Chemat | 25g | 1869.20 Pln |
| purity | 95% (stabilized with Copper chip) |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(iodomethyl)piperidine-1-carboxylate (CAS 253177-03-6) is a chemical compound with the molecular formula C11H20INO2 and a molecular weight of 325.19 g/mol. IUPAC name: tert-butyl 3-(iodomethyl)piperidine-1-carboxylate. InChIKey: GWYLEGFCHNTQTF-UHFFFAOYSA-N.
| Molecular formula | C11H20INO2 |
|---|---|
| Molecular weight | 325.19 g/mol |
| IUPAC name | tert-butyl 3-(iodomethyl)piperidine-1-carboxylate |
| InChIKey | GWYLEGFCHNTQTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)CI |
Computed by PubChem (NCBI)