cas: 892408-42-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-(tosyloxymethyl)azetidine-1-carboxylate, 95%, 95% (CAS 892408-42-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IFLY-1g |
| cas | 892408-42-3 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 549.20 Pln | |
| Chemat | 5g | 1950.80 Pln | |
| Chemat | 10g | 2896.40 Pln | |
| Chemat | 250mg | 256.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate (CAS 892408-42-3) is a chemical compound with the molecular formula C16H23NO5S and a molecular weight of 341.4 g/mol. IUPAC name: tert-butyl 3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate. InChIKey: BYWZHBHLUWHUKI-UHFFFAOYSA-N.
| Molecular formula | C16H23NO5S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | tert-butyl 3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate |
| InChIKey | BYWZHBHLUWHUKI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)