cas: 1260810-70-5 — see every product listed under this CAS number, including other names
tert-Butyl 3-{[(4-bromophenyl)methyl]amino}pyrrolidine-1-carboxylate, 97% (CAS 1260810-70-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609395-100MG |
| cas | 1260810-70-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 794.53 Pln | |
| Fluorochem | 250mg | 1039.24 Pln | |
| Fluorochem | 500mg | 1695.25 Pln | |
| Fluorochem | 1g | 2486.64 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[(4-bromophenyl)methylamino]pyrrolidine-1-carboxylate (CAS 1260810-70-5) is a chemical compound with the molecular formula C16H23BrN2O2 and a molecular weight of 355.27 g/mol. IUPAC name: tert-butyl 3-[(4-bromophenyl)methylamino]pyrrolidine-1-carboxylate. InChIKey: XMUSWGFWVBNSTM-UHFFFAOYSA-N.
| Molecular formula | C16H23BrN2O2 |
|---|---|
| Molecular weight | 355.27 g/mol |
| IUPAC name | tert-butyl 3-[(4-bromophenyl)methylamino]pyrrolidine-1-carboxylate |
| InChIKey | XMUSWGFWVBNSTM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)NCC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)