cas: 398491-64-0 — see every product listed under this CAS number, including other names
tert-Butyl 3-amino-6,7-dihydro-1H-pyrazolo[4,3-c]pyridine-5(4H)-carboxylate 98% (CAS 398491-64-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A617764-100mg |
| cas | 398491-64-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 820.94 Pln | |
| Ambeed | 5g | 2539.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A617764 |
Tert-butyl 3-amino-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate (CAS 398491-64-0) is a chemical compound with the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. IUPAC name: tert-butyl 3-amino-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate. InChIKey: AHGNLFYXPZBDMS-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O2 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | tert-butyl 3-amino-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate |
| InChIKey | AHGNLFYXPZBDMS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C(=NN2)N |
Computed by PubChem (NCBI)