cas: 355819-02-2 — see every product listed under this CAS number, including other names
tert-Butyl 3-amino-7,8-dihydro-1,6-naphthyridine-6(5h)-carboxylate, 95% (CAS 355819-02-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg, 2.5g, 5g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | HA-3713-250mg |
| cas | 355819-02-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 500mg | 289.50 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 2.5g | 841.39 Pln | |
| Fluorochem | 5g | 1611.95 Pln | |
| Fluorochem | 10g | 3168.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl 3-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 355819-02-2) is a chemical compound with the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. IUPAC name: tert-butyl 3-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: YHALGDJDGQKVHY-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2 |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | tert-butyl 3-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | YHALGDJDGQKVHY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(C=N2)N |
Computed by PubChem (NCBI)