cas: 856900-26-0 — see every product listed under this CAS number, including other names
tert-Butyl 3-cyano-8-azabicyclo[3.2.1]octane-8-carboxylate, 97% (CAS 856900-26-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F610376-100MG |
| cas | 856900-26-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 513.38 Pln | |
| Fluorochem | 1g | 1294.35 Pln | |
| Fluorochem | 5g | 3746.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-cyano-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 856900-26-0) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: tert-butyl 3-cyano-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: UVURMTGIVKSLEM-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | tert-butyl 3-cyano-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | UVURMTGIVKSLEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(C2)C#N |
Computed by PubChem (NCBI)