cas: 1025707-92-9 — see every product listed under this CAS number, including other names
tert-Butyl 3-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate, 98%, 98% (CAS 1025707-92-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1118QS-100mg |
| cas | 1025707-92-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 621.20 Pln | |
| Chemat | 10g | 1182.80 Pln | |
| Chemat | 25g | 2862.80 Pln | |
| Chemat | 250mg | 98.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 1025707-92-9) is a chemical compound with the molecular formula C20H26BNO5 and a molecular weight of 371.2 g/mol. IUPAC name: tert-butyl 3-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: JESCSZOSDNZDNX-UHFFFAOYSA-N.
| Molecular formula | C20H26BNO5 |
|---|---|
| Molecular weight | 371.2 g/mol |
| IUPAC name | tert-butyl 3-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | JESCSZOSDNZDNX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(C=C3C=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)