cas: 841286-80-4 — see every product listed under this CAS number, including other names
tert-Butyl 3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate 98% (CAS 841286-80-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A650737-250mg |
| cas | 841286-80-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 804.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A650737 |
Tert-butyl 3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate (CAS 841286-80-4) is a chemical compound with the molecular formula C12H23NO5 and a molecular weight of 261.31 g/mol. IUPAC name: tert-butyl 3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate. InChIKey: NJRYBJQLRONERE-UHFFFAOYSA-N.
| Molecular formula | C12H23NO5 |
|---|---|
| Molecular weight | 261.31 g/mol |
| IUPAC name | tert-butyl 3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate |
| InChIKey | NJRYBJQLRONERE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)O)(OC)OC |
Computed by PubChem (NCBI)