cas: 1211531-16-6 — see every product listed under this CAS number, including other names
tert-Butyl 3-methyl-5,6-dihydropyridine-1(2H)-carboxylate, 97%, 97% (CAS 1211531-16-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HFYD-100mg |
| cas | 1211531-16-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 500mg | 434.00 Pln | |
| Chemat | 1g | 702.80 Pln | |
| Chemat | 5g | 2603.60 Pln | |
| Chemat | 10g | 4307.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 1211531-16-6) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: tert-butyl 5-methyl-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: CGTRFKXCKHZQAV-UHFFFAOYSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | tert-butyl 5-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | CGTRFKXCKHZQAV-UHFFFAOYSA-N |
| SMILES | CC1=CCCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)