cas: 1447606-52-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-(((benzyloxy)carbonyl)amino)-4-(2-methoxy-2-oxoethyl)piperidine-1-carboxylate, 96%, 96% (CAS 1447606-52-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HX80-100mg |
| cas | 1447606-52-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 573.20 Pln | |
| Chemat | 1g | 1427.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(2-methoxy-2-oxoethyl)-4-(phenylmethoxycarbonylamino)piperidine-1-carboxylate (CAS 1447606-52-1) is a chemical compound with the molecular formula C21H30N2O6 and a molecular weight of 406.5 g/mol. IUPAC name: tert-butyl 4-(2-methoxy-2-oxoethyl)-4-(phenylmethoxycarbonylamino)piperidine-1-carboxylate. InChIKey: GGOCIPBIGXMLFK-UHFFFAOYSA-N.
| Molecular formula | C21H30N2O6 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | tert-butyl 4-(2-methoxy-2-oxoethyl)-4-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
| InChIKey | GGOCIPBIGXMLFK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CC(=O)OC)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)