cas: 288154-17-6 — see every product listed under this CAS number, including other names
tert-Butyl 4-(((benzyloxy)carbonyl)amino)-4-carbamoylpiperidine-1-carboxylate, 97%, 97% (CAS 288154-17-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113WML-250mg |
| cas | 288154-17-6 |
| size | 250mg |
| availability | 25.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 410.00 Pln | |
| Chemat | 10g | 664.40 Pln | |
| Chemat | 25g | 1418.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-carbamoyl-4-(phenylmethoxycarbonylamino)piperidine-1-carboxylate (CAS 288154-17-6) is a chemical compound with the molecular formula C19H27N3O5 and a molecular weight of 377.4 g/mol. IUPAC name: tert-butyl 4-carbamoyl-4-(phenylmethoxycarbonylamino)piperidine-1-carboxylate. InChIKey: FUDULMIGSCLWIF-UHFFFAOYSA-N.
| Molecular formula | C19H27N3O5 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | tert-butyl 4-carbamoyl-4-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
| InChIKey | FUDULMIGSCLWIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)N)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)