cas: 193537-11-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-(1-cyano-2-ethoxy-2-oxoethylidene)piperidine-1-carboxylate 97% (CAS 193537-11-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A661344-100mg |
| cas | 193537-11-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2728.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A661344 |
Tert-butyl 4-(1-cyano-2-ethoxy-2-oxoethylidene)piperidine-1-carboxylate (CAS 193537-11-0) is a chemical compound with the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. IUPAC name: tert-butyl 4-(1-cyano-2-ethoxy-2-oxoethylidene)piperidine-1-carboxylate. InChIKey: FYSWQLWLYPQLMR-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4 |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | tert-butyl 4-(1-cyano-2-ethoxy-2-oxoethylidene)piperidine-1-carboxylate |
| InChIKey | FYSWQLWLYPQLMR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C1CCN(CC1)C(=O)OC(C)(C)C)C#N |
Computed by PubChem (NCBI)