cas: 1073354-59-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperazine-1-carboxylate, 95% (CAS 1073354-59-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213778-100MG |
| cas | 1073354-59-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 5g | 2819.86 Pln | |
| Fluorochem | 10g | 4735.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate (CAS 1073354-59-2) is a chemical compound with the molecular formula C21H33BN2O4 and a molecular weight of 388.3 g/mol. IUPAC name: tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate. InChIKey: NMBIQPOMVHWFBF-UHFFFAOYSA-N.
| Molecular formula | C21H33BN2O4 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate |
| InChIKey | NMBIQPOMVHWFBF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2N3CCN(CC3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)