cas: 1401697-54-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetyl)piperazine-1-carboxylate, 97%, 97% (CAS 1401697-54-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DUCR-100mg |
| cas | 1401697-54-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| Chemat | 5g | 6818.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetyl]piperazine-1-carboxylate (CAS 1401697-54-8) is a chemical compound with the molecular formula C23H35BN2O6 and a molecular weight of 446.3 g/mol. IUPAC name: tert-butyl 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetyl]piperazine-1-carboxylate. InChIKey: RNOYZSQVIPJUDU-UHFFFAOYSA-N.
| Molecular formula | C23H35BN2O6 |
|---|---|
| Molecular weight | 446.3 g/mol |
| IUPAC name | tert-butyl 4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetyl]piperazine-1-carboxylate |
| InChIKey | RNOYZSQVIPJUDU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC(=O)N3CCN(CC3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)