cas: 352359-09-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2-aminoacetyl)piperazine-1-carboxylate 98% (CAS 352359-09-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A224690-250mg |
| cas | 352359-09-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1277.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A224690 |
Tert-butyl 4-(2-aminoacetyl)piperazine-1-carboxylate;hydrochloride (CAS 352359-09-2) is a chemical compound with the molecular formula C11H22ClN3O3 and a molecular weight of 279.76 g/mol. IUPAC name: tert-butyl 4-(2-aminoacetyl)piperazine-1-carboxylate;hydrochloride. InChIKey: WMXGPYSLNPZGCD-UHFFFAOYSA-N.
| Molecular formula | C11H22ClN3O3 |
|---|---|
| Molecular weight | 279.76 g/mol |
| IUPAC name | tert-butyl 4-(2-aminoacetyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | WMXGPYSLNPZGCD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)CN.Cl |
Computed by PubChem (NCBI)