cas: 156185-63-6 — see every product listed under this CAS number, including other names
tert-Butyl 4-(3-hydroxypropyl)tetrahydropyridine-1(2H)-carboxylate, 99.48% (CAS 156185-63-6) is a chemical reagent available from Chemat. Available pack sizes: 250 mg, 1 g, 50 g, 10 g, 25 g, 100 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-20880-250 mg |
| cas | 156185-63-6 |
| size | 250 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 250 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 310.40 Pln | |
| MedChemExpress | 50 g | 2400.20 Pln | |
| MedChemExpress | 10 g | 649.42 Pln | |
| MedChemExpress | 25 g | 1392.46 Pln | |
| MedChemExpress | 100 g | 4220.65 Pln | |
| MedChemExpress | 5 g | 445.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.48% |
Tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate (CAS 156185-63-6) is a chemical compound with the molecular formula C13H25NO3 and a molecular weight of 243.34 g/mol. IUPAC name: tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate. InChIKey: OXPWHPCCUXESFQ-UHFFFAOYSA-N.
| Molecular formula | C13H25NO3 |
|---|---|
| Molecular weight | 243.34 g/mol |
| IUPAC name | tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate |
| InChIKey | OXPWHPCCUXESFQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCCO |
Computed by PubChem (NCBI)