cas: 1092563-68-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-(3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)piperidine-1-carboxylate, 95% (CAS 1092563-68-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A255860-100mg |
| cas | 1092563-68-2 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 832.06 Pln | |
| Ambeed | 250mg | 1610.81 Pln | |
| Ambeed | 1g | 3941.50 Pln | |
| Chemat | 100mg | 712.40 Pln | |
| Chemat | 250mg | 1374.80 Pln | |
| Chemat | 500mg | 2637.20 Pln | |
| Chemat | 1g | 3366.80 Pln | |
| Chemat | 5g | 11642.00 Pln | |
| BLDpharm | 100mg | 891.93 Pln | |
| BLDpharm | 250mg | 1730.53 Pln | |
| BLDpharm | 1g | 4246.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 4-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate (CAS 1092563-68-2) is a chemical compound with the molecular formula C20H34BN3O4 and a molecular weight of 391.3 g/mol. IUPAC name: tert-butyl 4-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate. InChIKey: CEDVIMODHITMNP-UHFFFAOYSA-N.
| Molecular formula | C20H34BN3O4 |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | tert-butyl 4-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate |
| InChIKey | CEDVIMODHITMNP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2C)C3CCN(CC3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)