cas: 330794-35-9 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl),benzylcarbamate, 97%, 97% (CAS 330794-35-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1FZ-100mg |
| cas | 330794-35-9 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 10g | 285.20 Pln | |
| Chemat | 25g | 587.60 Pln | |
| Chemat | 50g | 1072.40 Pln | |
| Chemat | 100g | 1994.00 Pln | |
| Chemat | 250g | 4749.20 Pln | |
| Chemat | 500g | 5659.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate (CAS 330794-35-9) is a chemical compound with the molecular formula C18H28BNO4 and a molecular weight of 333.2 g/mol. IUPAC name: tert-butyl N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate. InChIKey: CUDCEJRRWNIPDL-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO4 |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | tert-butyl N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate |
| InChIKey | CUDCEJRRWNIPDL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)