cas: 1501970-55-3 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4-chloro-1H-pyrazol-1-yl)piperidine-1-carboxylate, 96%, 96% (CAS 1501970-55-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXRZ-100mg |
| cas | 1501970-55-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 746.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(4-chloropyrazol-1-yl)piperidine-1-carboxylate (CAS 1501970-55-3) is a chemical compound with the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. IUPAC name: tert-butyl 4-(4-chloropyrazol-1-yl)piperidine-1-carboxylate. InChIKey: XJGFXWMMTOEADD-UHFFFAOYSA-N.
| Molecular formula | C13H20ClN3O2 |
|---|---|
| Molecular weight | 285.77 g/mol |
| IUPAC name | tert-butyl 4-(4-chloropyrazol-1-yl)piperidine-1-carboxylate |
| InChIKey | XJGFXWMMTOEADD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N2C=C(C=N2)Cl |
Computed by PubChem (NCBI)