cas: 1073355-13-1 — see every product listed under this CAS number, including other names
tert-Butyl 4-(4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)piperazine-1-carboxylate, 95% (CAS 1073355-13-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 25g, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A580918-100mg |
| cas | 1073355-13-1 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 473.62 Pln | |
| AmBeed | 25g | 20381.20 Pln | |
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 2424.16 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 4-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate (CAS 1073355-13-1) is a chemical compound with the molecular formula C21H34BN3O4 and a molecular weight of 403.3 g/mol. IUPAC name: tert-butyl 4-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate. InChIKey: CQYHKQXSKLVNHE-UHFFFAOYSA-N.
| Molecular formula | C21H34BN3O4 |
|---|---|
| Molecular weight | 403.3 g/mol |
| IUPAC name | tert-butyl 4-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate |
| InChIKey | CQYHKQXSKLVNHE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2C)N3CCN(CC3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)