cas: 280110-63-6 — see every product listed under this CAS number, including other names
tert-Butyl 4-(N-hydroxycarbamimidoyl)piperidine-1-carboxylate 97% (CAS 280110-63-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A282275-250mg |
| cas | 280110-63-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 553.94 Pln | |
| Ambeed | 5g | 1755.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A282275 |
Tert-butyl 4-[(Z)-N'-hydroxycarbamimidoyl]piperidine-1-carboxylate (CAS 280110-63-6) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl 4-[(Z)-N'-hydroxycarbamimidoyl]piperidine-1-carboxylate. InChIKey: KMBRLTGPGNMNIY-UHFFFAOYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl 4-[(Z)-N'-hydroxycarbamimidoyl]piperidine-1-carboxylate |
| InChIKey | KMBRLTGPGNMNIY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)/C(=N/O)/N |
Computed by PubChem (NCBI)