cas: 1121596-60-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-(o-tolyl)piperazine-1-carboxylate, 95-<97% (CAS 1121596-60-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5361-95-97-10g |
| cas | 1121596-60-8 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 5022.82 Pln | |
| Hoffman Fine Chemicals | 25g | 9737.64 Pln | |
| Hoffman Fine Chemicals | 50g | 15396.70 Pln | |
| Hoffman Fine Chemicals | 100g | 24456.30 Pln | |
| Hoffman Fine Chemicals | 200g | 41363.30 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Tert-butyl 4-(2-methylphenyl)piperazine-1-carboxylate (CAS 1121596-60-8) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 276.37 g/mol. IUPAC name: tert-butyl 4-(2-methylphenyl)piperazine-1-carboxylate. InChIKey: PWBKAWVRUDWXDT-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 276.37 g/mol |
| IUPAC name | tert-butyl 4-(2-methylphenyl)piperazine-1-carboxylate |
| InChIKey | PWBKAWVRUDWXDT-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)