cas: 1349718-24-6 — see every product listed under this CAS number, including other names
tert-Butyl 4-(oxetan-3-ylamino)piperidine-1-carboxylate, 97% (CAS 1349718-24-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A427418-5g |
| cas | 1349718-24-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9157.96 Pln | |
| AmBeed | 10g | 15212.26 Pln | |
| Fluorochem | 100mg | 909.07 Pln | |
| Fluorochem | 250mg | 1190.22 Pln | |
| Fluorochem | 500mg | 1934.75 Pln | |
| Fluorochem | 1g | 2871.92 Pln | |
| Fluorochem | 5g | 8448.08 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 4-(oxetan-3-ylamino)piperidine-1-carboxylate (CAS 1349718-24-6) is a chemical compound with the molecular formula C13H24N2O3 and a molecular weight of 256.34 g/mol. IUPAC name: tert-butyl 4-(oxetan-3-ylamino)piperidine-1-carboxylate. InChIKey: SRLOABIBNBVMQB-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O3 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | tert-butyl 4-(oxetan-3-ylamino)piperidine-1-carboxylate |
| InChIKey | SRLOABIBNBVMQB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NC2COC2 |
Computed by PubChem (NCBI)